Difference between revisions of "DIPHTINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19217 == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-...")
(Created page with "Category:metabolite == Metabolite ARG-tRNAs == * common-name: ** a trnaarg == Reaction(s) known to consume the compound == * ARGININE--TRNA-LIGASE-RXN == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19217 ==
+
== Metabolite ARG-tRNAs ==
 
* common-name:
 
* common-name:
** s-(hydroxysulfenamide)-glutathione
+
** a trnaarg
* smiles:
 
** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** zoiidzwlsvvtgq-wdskdsinsa-m
 
* molecular-weight:
 
** 337.327
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17884]]
+
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[RXN-17888]]
 +
* [[RXN-17889]]
 +
* [[RXN-17890]]
 +
* [[RXN-17891]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(hydroxysulfenamide)-glutathione}}
+
{{#set: common-name=a trnaarg}}
{{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}}
 
{{#set: molecular-weight=337.327}}
 

Revision as of 18:52, 14 January 2021

Metabolite ARG-tRNAs

  • common-name:
    • a trnaarg

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality