Difference between revisions of "DISSULFRED-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25S-rRNA-adenine-645 25S-rRNA-adenine-645] == * common-name: ** adenine645 in 25s rrna == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25S-rRNA-adenine-645 25S-rRNA-adenine-645] ==
 
* common-name:
 
* common-name:
** imp
+
** adenine645 in 25s rrna
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* inchi-key:
 
** grszfwquakgdav-kqynxxcusa-l
 
* molecular-weight:
 
** 346.193
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[RXN-14550]]
* [[HPRT]]
 
* [[I5NT]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[RXN-7607]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMP-DEAMINASE-RXN]]
 
* [[GMP-REDUCT-RXN]]
 
* [[HPRT]]
 
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[ITPP]]
 
* [[RXN-14003]]
 
* [[RXN0-6382]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imp}}
+
{{#set: common-name=adenine645 in 25s rrna}}
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 
{{#set: molecular-weight=346.193}}
 

Revision as of 14:18, 26 August 2019

Metabolite 25S-rRNA-adenine-645

  • common-name:
    • adenine645 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality