Difference between revisions of "DITHIOTHREITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SEPO3 == * common-name: ** selenophosphate * smiles: ** [o-]p([o-])(o)=[se] * inchi-key: ** jrphgdyskgjtkz-uhfffaoysa-l * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MANNOSE-1P == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-mannose 1-phosphate |
* smiles: | * smiles: | ||
| − | ** [o-] | + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hxxfsfrbohsimq-rwopyejcsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[MANNPGUANYLTRANGDP-RXN]] |
| + | * [[PHOSMANMUT-RXN]] | ||
| + | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
| + | * [[RXN4FS-12]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[MANNPGUANYLTRANGDP-RXN]] |
| + | * [[PHOSMANMUT-RXN]] | ||
| + | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-mannose 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite MANNOSE-1P
- common-name:
- α-d-mannose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-rwopyejcsa-l
- molecular-weight:
- 258.121
