Difference between revisions of "DITHIOTHREITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...") |
(Created page with "Category:metabolite == Metabolite DITHIOTHREITOL == * common-name: ** l-dithiothreitol * smiles: ** c(s)c(o)c(o)cs * inchi-key: ** vhjlvaabsrfdpm-imjsidkusa-n * molecular-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DITHIOTHREITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-dithiothreitol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(s)c(o)c(o)cs |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vhjlvaabsrfdpm-imjsidkusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 154.242 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.4.1-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.4.1-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-dithiothreitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vhjlvaabsrfdpm-imjsidkusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=154.242}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DITHIOTHREITOL
- common-name:
- l-dithiothreitol
- smiles:
- c(s)c(o)c(o)cs
- inchi-key:
- vhjlvaabsrfdpm-imjsidkusa-n
- molecular-weight:
- 154.242
