Difference between revisions of "DITHIOTHREITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7005 == * common-name: ** geranylgeranyl chlorophyll a * smiles: ** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c...")
(Created page with "Category:metabolite == Metabolite CPD-178 == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7005 ==
+
== Metabolite CPD-178 ==
 
* common-name:
 
* common-name:
** geranylgeranyl chlorophyll a
+
** d-myo-inositol (3,4,5,6)-tetrakisphosphate
 
* smiles:
 
* smiles:
** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
+
** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** qblsepresqjtci-znlwzyposa-m
+
** mrvyfoanpdtyby-uzaagftcsa-f
 
* molecular-weight:
 
* molecular-weight:
** 886.447
+
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17428]]
+
* [[2.7.1.134-RXN]]
* [[RXN-7664]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7663]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl chlorophyll a}}
+
{{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}}
{{#set: inchi-key=inchikey=qblsepresqjtci-znlwzyposa-m}}
+
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}}
{{#set: molecular-weight=886.447}}
+
{{#set: molecular-weight=492.013}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-178

  • common-name:
    • d-myo-inositol (3,4,5,6)-tetrakisphosphate
  • smiles:
    • c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • mrvyfoanpdtyby-uzaagftcsa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality