Difference between revisions of "DITP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3188 == * common-name: ** n'-hydroxymethyl-norcotinine * smiles: ** c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2)) * inchi-key: ** gqufobhepvfqm...") |
(Created page with "Category:metabolite == Metabolite DITP == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DITP == |
* common-name: | * common-name: | ||
− | ** | + | ** ditp |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ufjpaqslhagebl-rrkcrqdmsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 488.137 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14228]] | ||
+ | * [[RXN0-1602]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14228]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ditp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=488.137}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DITP
- common-name:
- ditp
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- ufjpaqslhagebl-rrkcrqdmsa-j
- molecular-weight:
- 488.137