Difference between revisions of "DIVINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14423 == * common-name: ** 3-oxo-docosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
(Created page with "Category:metabolite == Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14423 ==
+
== Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** 3-oxo-docosapentaenoyl-coa
+
** 3,8-divinyl protochlorophyllide a
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** slykkqsprfjdaf-hvganwhpsa-j
 
 
* molecular-weight:
 
* molecular-weight:
** 1089.98
+
** 608.935
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13443]]
+
* [[RXN-5285]]
 +
* [[RXN1F-72]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1F-72]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-docosapentaenoyl-coa}}
+
{{#set: common-name=3,8-divinyl protochlorophyllide a}}
{{#set: inchi-key=inchikey=slykkqsprfjdaf-hvganwhpsa-j}}
+
{{#set: molecular-weight=608.935}}
{{#set: molecular-weight=1089.98}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 3,8-divinyl protochlorophyllide a
  • molecular-weight:
    • 608.935

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality