Difference between revisions of "DIVINYLCHLOROPHYLLIDE-A"

Revision as of 08:26, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI ==
+== Metabolite FE+2 ==
 * common-name:
-** leukotriene b4
+** fe2+
 * smiles:
-** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
+** [fe++]
 * inchi-key:
-** vnyssyrcgwbhlg-amolwhmgsa-m
+** cwynvvgooaeacu-uhfffaoysa-n
 * molecular-weight:
-** 335.462
+** 55.847
 == Reaction(s) known to consume the compound ==
+* [[ExchangeSeed-FE+2]]
+* [[FE2GTPabc]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[PROTOHEMEFERROCHELAT-RXN]]
+* [[RXN-17518]]
+* [[RXN0-1483]]
+* [[SIROHEME-FERROCHELAT-RXN]]
+* [[TransportSeed-FE+2]]
 == Reaction(s) known to produce the compound ==
-* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+* [[ExchangeSeed-FE+2]]
+* [[FE2GTPabc]]
+* [[FESO3OXI-RXN]]
+* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[PROTOHEMEFERROCHELAT-RXN]]
+* [[RXN-15598]]
+* [[RXN-17523]]
+* [[TransportSeed-FE+2]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=leukotriene b4}}
+{{#set: common-name=fe2+}}
-{{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}}
+{{#set: inchi-key=inchikey=cwynvvgooaeacu-uhfffaoysa-n}}
-{{#set: molecular-weight=335.462}}
+{{#set: molecular-weight=55.847}}