Difference between revisions of "DIVINYLCHLOROPHYLLIDE-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12018 == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) * inchi-key: ** jtejppkmybdemy-uhfffaoysa-...")
(Created page with "Category:metabolite == Metabolite DIVINYLCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12018 ==
+
== Metabolite DIVINYLCHLOROPHYLLIDE-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** 5-methoxytryptamine
+
** 3,8-divinyl chlorophyllide a
* smiles:
 
** coc2(c=cc1(=c(c(ccn)=cn1)c=2))
 
* inchi-key:
 
** jtejppkmybdemy-uhfffaoysa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 190.244
+
** 610.951
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11067]]
+
* [[RXN-5286]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-5285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methoxytryptamine}}
+
{{#set: common-name=3,8-divinyl chlorophyllide a}}
{{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}}
+
{{#set: molecular-weight=610.951}}
{{#set: molecular-weight=190.244}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite DIVINYLCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 3,8-divinyl chlorophyllide a
  • molecular-weight:
    • 610.951

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality