Difference between revisions of "DL-12-Propanediol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))n...")
(Created page with "Category:metabolite == Metabolite DL-12-Propanediol == * common-name: ** propane-1,2-diol == Reaction(s) known to consume the compound == * RXN-17622 == Reaction(s) kn...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17049 ==
+
== Metabolite DL-12-Propanediol ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** propane-1,2-diol
* smiles:
 
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
 
* inchi-key:
 
** vzgsjjjqzptkgr-vxgbxaggsa-n
 
* molecular-weight:
 
** 298.374
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15684]]
+
* [[RXN-17622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17617]]
 +
* [[RXN-17622]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=propane-1,2-diol}}
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
 
{{#set: molecular-weight=298.374}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite DL-12-Propanediol

  • common-name:
    • propane-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality