Difference between revisions of "DMPBQ"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...") |
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DMPBQ == |
* common-name: | * common-name: | ||
− | ** | + | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sufzkubnovdjrr-wgeodtkdsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 416.686 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-2542]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sufzkubnovdjrr-wgeodtkdsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=416.686}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DMPBQ
- common-name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
- inchi-key:
- sufzkubnovdjrr-wgeodtkdsa-n
- molecular-weight:
- 416.686