Difference between revisions of "DMPBQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...")
(Created page with "Category:metabolite == Metabolite CYTOSINE == * common-name: ** cytosine * smiles: ** c1(nc(=o)n=c(n)c=1) * inchi-key: ** optasplrgrrnap-uhfffaoysa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
+
== Metabolite CYTOSINE ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4)-trisphosphate
+
** cytosine
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c1(nc(=o)n=c(n)c=1)
 
* inchi-key:
 
* inchi-key:
** mmwciqzxvozegg-mlqgymepsa-h
+
** optasplrgrrnap-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 414.049
+
** 111.103
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.133-RXN]]
 
* [[2.7.1.139-RXN]]
 
* [[RXN-10939]]
 
* [[RXN-10959]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8730]]
+
* [[RXN0-361]]
 +
* [[RXN0-985]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
+
{{#set: common-name=cytosine}}
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
+
{{#set: inchi-key=inchikey=optasplrgrrnap-uhfffaoysa-n}}
{{#set: molecular-weight=414.049}}
+
{{#set: molecular-weight=111.103}}

Revision as of 15:28, 5 January 2021

Metabolite CYTOSINE

  • common-name:
    • cytosine
  • smiles:
    • c1(nc(=o)n=c(n)c=1)
  • inchi-key:
    • optasplrgrrnap-uhfffaoysa-n
  • molecular-weight:
    • 111.103

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality