Difference between revisions of "DNA-6-O-Methyl-Guanines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc...")
(Created page with "Category:metabolite == Metabolite DNA-6-O-Methyl-Guanines == * common-name: ** an o6-methylguanine in dna == Reaction(s) known to consume the compound == * [[2.1.1.63-RXN]...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17403 ==
+
== Metabolite DNA-6-O-Methyl-Guanines ==
 
* common-name:
 
* common-name:
−
** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
+
** an o6-methylguanine in dna
−
* smiles:
 
−
** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
−
* inchi-key:
 
−
** gccbkkqiemqvgw-pkayedjnsa-j
 
−
* molecular-weight:
 
−
** 1067.974
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.63-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16155]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa}}
+
{{#set: common-name=an o6-methylguanine in dna}}
−
{{#set: inchi-key=inchikey=gccbkkqiemqvgw-pkayedjnsa-j}}
 
−
{{#set: molecular-weight=1067.974}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite DNA-6-O-Methyl-Guanines

  • common-name:
    • an o6-methylguanine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DNA-6-O-Methyl-Guanines&oldid=137230"