Difference between revisions of "DNA-Combined-With-Exogenous-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OHyWstar-tRNA == * common-name: ** 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] * inchi-key: ** drbbfclwyr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OHyWstar-tRNA ==
+
== Metabolite CREATINE-P ==
 
* common-name:
 
* common-name:
** 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe
+
** nω-phosphocreatine
 +
* smiles:
 +
** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
 +
* inchi-key:
 +
** drbbfclwyrjsjz-uhfffaoysa-l
 +
* molecular-weight:
 +
** 209.098
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14539]]
+
* [[CREATINE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CREATINE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe}}
+
{{#set: common-name=nω-phosphocreatine}}
 +
{{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}}
 +
{{#set: molecular-weight=209.098}}

Revision as of 11:12, 15 January 2021

Metabolite CREATINE-P

  • common-name:
    • nω-phosphocreatine
  • smiles:
    • c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
  • inchi-key:
    • drbbfclwyrjsjz-uhfffaoysa-l
  • molecular-weight:
    • 209.098

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality