Difference between revisions of "DNA-Containing-N6-Methyladenine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA == * common-name: ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol * smiles: ** cc(c)c(=c)cc...") |
(Created page with "Category:metabolite == Metabolite CPD-17540 == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** wsfqksibzodgpb-o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17540 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dapdiamide b |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wsfqksibzodgpb-ofaneystsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 314.341 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16292]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dapdiamide b}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=314.341}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD-17540
- common-name:
- dapdiamide b
- smiles:
- ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
- inchi-key:
- wsfqksibzodgpb-ofaneystsa-n
- molecular-weight:
- 314.341
