Difference between revisions of "DNA-Guanines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Histidines == * common-name: ** a [protein]-l-histidine == Reaction(s) known to consume the compound == * 2.7.13.3-RXN * RX...") |
(Created page with "Category:metabolite == Metabolite CPD-3723 == * common-name: ** uridine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3723 == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine 2'-monophosphate |
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2)) | ||
| + | * inchi-key: | ||
| + | ** hqidpeytetucnf-xvfcmesisa-l | ||
| + | * molecular-weight: | ||
| + | ** 322.168 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12060]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine 2'-monophosphate}} |
| + | {{#set: inchi-key=inchikey=hqidpeytetucnf-xvfcmesisa-l}} | ||
| + | {{#set: molecular-weight=322.168}} | ||
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-3723
- common-name:
- uridine 2'-monophosphate
- smiles:
- c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- hqidpeytetucnf-xvfcmesisa-l
- molecular-weight:
- 322.168
