Difference between revisions of "DNA-Guanines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7409 == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c...")
(Created page with "Category:metabolite == Metabolite DNA-Guanines == * common-name: ** a guanine in dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the co...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7409 ==
+
== Metabolite DNA-Guanines ==
 
* common-name:
 
* common-name:
** β-cryptoxanthin
+
** a guanine in dna
* smiles:
 
** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
 
* inchi-key:
 
** dmaslkhvqrhnes-fkkupvfpsa-n
 
* molecular-weight:
 
** 552.882
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8026]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8025]]
+
* [[2.1.1.63-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-cryptoxanthin}}
+
{{#set: common-name=a guanine in dna}}
{{#set: inchi-key=inchikey=dmaslkhvqrhnes-fkkupvfpsa-n}}
 
{{#set: molecular-weight=552.882}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite DNA-Guanines

  • common-name:
    • a guanine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality