Difference between revisions of "DNA-Guanines"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07231 == * transcription-direction: ** negative * right-end-position: ** 1137985 * left-end-position: ** 1131578 * centisome-position: ** 77.448265...") |
(Created page with "Category:metabolite == Metabolite CPD-7409 == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7409 == |
| − | * | + | * common-name: |
| − | ** | + | ** β-cryptoxanthin |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c |
| − | * | + | * inchi-key: |
| − | ** | + | ** dmaslkhvqrhnes-fkkupvfpsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 552.882 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8026]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-8025]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=β-cryptoxanthin}} | |
| − | + | {{#set: inchi-key=inchikey=dmaslkhvqrhnes-fkkupvfpsa-n}} | |
| − | + | {{#set: molecular-weight=552.882}} | |
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-7409
- common-name:
- β-cryptoxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
- inchi-key:
- dmaslkhvqrhnes-fkkupvfpsa-n
- molecular-weight:
- 552.882
