Difference between revisions of "DNA-Holder"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
(Created page with "Category:metabolite == Metabolite NN-DIMETHYLANILINE-N-OXIDE == * common-name: ** n,n-dimethylaniline-n-oxide * smiles: ** cn(c)(=o)c1(c=cc=cc=1) * inchi-key: ** lkqudaoam...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NN-DIMETHYLANILINE-N-OXIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** n,n-dimethylaniline-n-oxide |
* smiles: | * smiles: | ||
− | ** | + | ** cn(c)(=o)c1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lkqudaoambkkqw-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 137.181 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.14.13.8-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n,n-dimethylaniline-n-oxide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lkqudaoambkkqw-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.181}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite NN-DIMETHYLANILINE-N-OXIDE
- common-name:
- n,n-dimethylaniline-n-oxide
- smiles:
- cn(c)(=o)c1(c=cc=cc=1)
- inchi-key:
- lkqudaoambkkqw-uhfffaoysa-n
- molecular-weight:
- 137.181