Difference between revisions of "DNA-Holder"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-CYSTEINE == * common-name: ** d-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inchi-key: ** xujnekjlayxesh-uwtatzphsa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UDP-SULFOQUINOVOSE == |
* common-name: | * common-name: | ||
| − | ** d- | + | ** udp-α-d-sulfoquinovopyranose |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fqancgqcbcusmi-jzmiexbbsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 627.34 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-1223]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=udp-α-d-sulfoquinovopyranose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=627.34}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite UDP-SULFOQUINOVOSE
- common-name:
- udp-α-d-sulfoquinovopyranose
- smiles:
- c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
- inchi-key:
- fqancgqcbcusmi-jzmiexbbsa-k
- molecular-weight:
- 627.34
