Difference between revisions of "DNA-Ligase-L-lysine-adenylate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite R-3-hydroxycerotoyl-ACPs == * common-name: ** a (3r)-3-hydroxycerotoyl-[acp] == Reaction(s) known to consume the compound == * RXN-1006...")
(Created page with "Category:metabolite == Metabolite CPD-15691 == * common-name: ** (5e)-3-oxo-dodec-5-enoyl-coa * smiles: ** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite R-3-hydroxycerotoyl-ACPs ==
+
== Metabolite CPD-15691 ==
 
* common-name:
 
* common-name:
** a (3r)-3-hydroxycerotoyl-[acp]
+
** (5e)-3-oxo-dodec-5-enoyl-coa
 +
* smiles:
 +
** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** vklhslowdwgvgp-woabmhmmsa-j
 +
* molecular-weight:
 +
** 957.775
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10061]]
+
* [[RXN-14803]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10060]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r)-3-hydroxycerotoyl-[acp]}}
+
{{#set: common-name=(5e)-3-oxo-dodec-5-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=vklhslowdwgvgp-woabmhmmsa-j}}
 +
{{#set: molecular-weight=957.775}}

Revision as of 08:29, 15 March 2021

Metabolite CPD-15691

  • common-name:
    • (5e)-3-oxo-dodec-5-enoyl-coa
  • smiles:
    • ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vklhslowdwgvgp-woabmhmmsa-j
  • molecular-weight:
    • 957.775

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality