Difference between revisions of "DNA-Ligase-L-lysine-adenylate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...")
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine-adenylate == * common-name: ** a [dna ligase]-n6-(5'-adenylyl)-l-lysine == Reaction(s) known to consume the compound...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-D-GLUCOSE ==
+
== Metabolite DNA-Ligase-L-lysine-adenylate ==
 
* common-name:
 
* common-name:
** gdp-α-d-glucose
+
** a [dna ligase]-n6-(5'-adenylyl)-l-lysine
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
 
* inchi-key:
 
** mvmscbbuihutgj-lrjdveewsa-l
 
* molecular-weight:
 
** 603.329
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12486]]
+
* [[RXN-17918]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12486]]
+
* [[RXN-17917]]
* [[RXN4FS-13]]
+
* [[RXN-17920]]
 +
* [[RXN-17924]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-glucose}}
+
{{#set: common-name=a [dna ligase]-n6-(5'-adenylyl)-l-lysine}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
 
{{#set: molecular-weight=603.329}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite DNA-Ligase-L-lysine-adenylate

  • common-name:
    • a [dna ligase]-n6-(5'-adenylyl)-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [dna ligase]-n6-(5'-adenylyl)-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.