Difference between revisions of "DNA-N"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite OROTIDINE-5-PHOSPHATE ==
+== Metabolite DNA-N ==
 * common-name:
-** orotidine 5'-phosphate
+** dnan
-* smiles:
-** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
-* inchi-key:
-** kyobshfobaofbf-xvfcmesisa-k
-* molecular-weight:
-** 365.17
 == Reaction(s) known to consume the compound ==
-* [[OROPRIBTRANS-RXN]]
+* [[3.1.11.1-RXN]]
-* [[OROTPDECARB-RXN]]
+* [[3.1.11.2-RXN]]
-* [[ORPDC]]
+* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
-* [[ORPRT]]
+* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+* [[RXN0-4961]]
 == Reaction(s) known to produce the compound ==
-* [[OROPRIBTRANS-RXN]]
+* [[3.1.11.1-RXN]]
-* [[ORPRT]]
+* [[3.1.11.2-RXN]]
+* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+* [[DNA-LIGASE-ATP-RXN]]
+* [[DNA-LIGASE-NAD+-RXN]]
+* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+* [[RXN-15712]]
+* [[RXN-15713]]
+* [[RXN-17919]]
+* [[RXN-17923]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=orotidine 5'-phosphate}}
+{{#set: common-name=dnan}}
-{{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}}
-{{#set: molecular-weight=365.17}}