|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVIN-SYN-RXN RIBOFLAVIN-SYN-RXN] == | + | == Metabolite MI-HEXAKISPHOSPHATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** riboflavin synthase | + | ** phytate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.5.1.9 ec-2.5.1.9] | + | ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 2 [[DIMETHYL-D-RIBITYL-LUMAZINE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE]][c] '''+''' 1 [[RIBOFLAVIN]][c]
| + | ** imqlkjbteoyosi-gpivlxjgsa-b |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ11166]]
| + | ** 647.942 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[2.7.1.152-RXN]] |
| − | ** Category: [[orthology]] | + | * [[RXN-10971]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-10972]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-10977]] |
| − | == Pathway(s) == | + | * [[RXN-10978]] |
| − | * [[RIBOSYN2-PWY]], flavin biosynthesis I (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] | + | * [[RXN-7186]] |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | * [[RXN-7241]] |
| − | * [[PWY-6167]], flavin biosynthesis II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6167 PWY-6167] | + | == Reaction(s) known to produce the compound == |
| − | ** '''5''' reactions found over '''10''' reactions in the full pathway
| + | * [[RXN-10964]] |
| − | * [[PWY-6168]], flavin biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168] | + | * [[RXN-10977]] |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway | + | * [[RXN-10978]] |
| − | == Reconstruction information ==
| + | * [[RXN-7163]] |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | * [[RXN-7186]] |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | {{#set: common-name=phytate}} |
| − | == External links == | + | {{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}} |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | {{#set: molecular-weight=647.942}} |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20773 20773]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00066 R00066]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P11998 P11998]
| |
| − | ** [http://www.uniprot.org/uniprot/P16440 P16440]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JUA6 Q9JUA6]
| |
| − | ** [http://www.uniprot.org/uniprot/O24854 O24854]
| |
| − | ** [http://www.uniprot.org/uniprot/O26237 O26237]
| |
| − | ** [http://www.uniprot.org/uniprot/P66037 P66037]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CGU8 Q9CGU8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9YDC5 Q9YDC5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PN77 Q9PN77]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CGU6 Q9CGU6]
| |
| − | ** [http://www.uniprot.org/uniprot/P45273 P45273]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIB9 Q9PIB9]
| |
| − | ** [http://www.uniprot.org/uniprot/O66529 O66529]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58584 Q58584]
| |
| − | ** [http://www.uniprot.org/uniprot/O28856 O28856]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01994 Q01994]
| |
| − | ** [http://www.uniprot.org/uniprot/P61714 P61714]
| |
| − | ** [http://www.uniprot.org/uniprot/P0AFU8 P0AFU8]
| |
| − | ** [http://www.uniprot.org/uniprot/P38145 P38145]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55532 Q55532]
| |
| − | ** [http://www.uniprot.org/uniprot/P73527 P73527]
| |
| − | ** [http://www.uniprot.org/uniprot/Q44680 Q44680]
| |
| − | ** [http://www.uniprot.org/uniprot/Q44681 Q44681]
| |
| − | ** [http://www.uniprot.org/uniprot/P50854 P50854]
| |
| − | ** [http://www.uniprot.org/uniprot/P50856 P50856]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=riboflavin synthase}} | |
| − | {{#set: ec-number=ec-2.5.1.9}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
| |
