Difference between revisions of "DNA-N4-Methylcytosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MI-HEXAKISPHOSPHATE == * common-name: ** phytate * smiles: ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o...")
(Created page with "Category:metabolite == Metabolite R-3-hydroxyarachidoyl-ACPs == * common-name: ** a (3r)-3-hydroxyarachidoyl-[acp] == Reaction(s) known to consume the compound == * RXN1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MI-HEXAKISPHOSPHATE ==
+
== Metabolite R-3-hydroxyarachidoyl-ACPs ==
 
* common-name:
 
* common-name:
** phytate
+
** a (3r)-3-hydroxyarachidoyl-[acp]
* smiles:
 
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** imqlkjbteoyosi-gpivlxjgsa-b
 
* molecular-weight:
 
** 647.942
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.152-RXN]]
+
* [[RXN1G-320]]
* [[RXN-10971]]
 
* [[RXN-10972]]
 
* [[RXN-10977]]
 
* [[RXN-10978]]
 
* [[RXN-7186]]
 
* [[RXN-7241]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10964]]
+
* [[RXN1G-349]]
* [[RXN-10977]]
 
* [[RXN-10978]]
 
* [[RXN-7163]]
 
* [[RXN-7186]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytate}}
+
{{#set: common-name=a (3r)-3-hydroxyarachidoyl-[acp]}}
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
 
{{#set: molecular-weight=647.942}}
 

Revision as of 14:58, 5 January 2021

Metabolite R-3-hydroxyarachidoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxyarachidoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyarachidoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.