Difference between revisions of "DNA-N4-Methylcytosine"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVIN-SYN-RXN RIBOFLAVIN-SYN-RXN] == * direction: ** left-to-right * common-name: ** riboflavi...") |
(Created page with "Category:metabolite == Metabolite MI-HEXAKISPHOSPHATE == * common-name: ** phytate * smiles: ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite MI-HEXAKISPHOSPHATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** phytate |
− | * | + | * smiles: |
− | ** [ | + | ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1) |
− | + | * inchi-key: | |
− | + | ** imqlkjbteoyosi-gpivlxjgsa-b | |
− | = | + | * molecular-weight: |
− | + | ** 647.942 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[2.7.1.152-RXN]] |
− | ** | + | * [[RXN-10971]] |
− | * | + | * [[RXN-10972]] |
− | ** | + | * [[RXN-10977]] |
− | == | + | * [[RXN-10978]] |
− | * [[ | + | * [[RXN-7186]] |
− | + | * [[RXN-7241]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10964]] | |
− | * [[ | + | * [[RXN-10977]] |
− | * | + | * [[RXN-10978]] |
− | + | * [[RXN-7163]] | |
− | + | * [[RXN-7186]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=phytate}} |
− | == | + | {{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}} |
− | + | {{#set: molecular-weight=647.942}} | |
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite MI-HEXAKISPHOSPHATE
- common-name:
- phytate
- smiles:
- c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
- inchi-key:
- imqlkjbteoyosi-gpivlxjgsa-b
- molecular-weight:
- 647.942