Difference between revisions of "DNA-containing-a-Apyrimidinic-Sites"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19623 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5-METHYLTHIOADENOSINE == |
| − | == | + | * common-name: |
| − | * [[ | + | ** s-methyl-5'-thioadenosine |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
| − | ** | + | * inchi-key: |
| − | *** | + | ** wuugfsxjnotrmr-ioslpcccsa-n |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 297.331 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[M5TAP]] | ||
| + | * [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]] | ||
| + | * [[RXN-11190]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[4.4.1.14-RXN]] | ||
| + | * [[APAPT]] | ||
| + | * [[RXN-11190]] | ||
| + | * [[RXN-11371]] | ||
| + | * [[RXN-14518]] | ||
| + | * [[RXN0-5217]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
| + | * [[SPERMINE-SYNTHASE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=s-methyl-5'-thioadenosine}} | ||
| + | {{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}} | ||
| + | {{#set: molecular-weight=297.331}} | ||
Revision as of 20:33, 18 December 2020
Contents
Metabolite 5-METHYLTHIOADENOSINE
- common-name:
- s-methyl-5'-thioadenosine
- smiles:
- cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- wuugfsxjnotrmr-ioslpcccsa-n
- molecular-weight:
- 297.331
