Difference between revisions of "DNA-containing-aPurinic-Sites"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ETHYLENE-CMPD == * common-name: ** ethene * smiles: ** c=c * inchi-key: ** vggsqfucumxweo-uhfffaoysa-n * molecular-weight: ** 28.054 == R...") |
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SOLANESYL-PYROPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-nonaprenyl diphosphate |
* smiles: | * smiles: | ||
| − | ** c=c | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ivlbhbftrnviap-meggaxogsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 788.015 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-2761]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11486]] |
| + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-nonaprenyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=788.015}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite SOLANESYL-PYROPHOSPHATE
- common-name:
- all-trans-nonaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ivlbhbftrnviap-meggaxogsa-k
- molecular-weight:
- 788.015
