Difference between revisions of "DNA-deoxycytidine-thymidine-dimer"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylguanine-10 == * common-name: ** an n2-methylguanine10 in trna == Reaction(s) known to consume the compound == ==...")
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-Containing-N2-Methylguanine-10 ==
+
== Metabolite UDP-SULFOQUINOVOSE ==
 
* common-name:
 
* common-name:
** an n2-methylguanine10 in trna
+
** udp-α-d-sulfoquinovopyranose
 +
* smiles:
 +
** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
 +
* inchi-key:
 +
** fqancgqcbcusmi-jzmiexbbsa-k
 +
* molecular-weight:
 +
** 627.34
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12374]]
+
* [[RXN-1223]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n2-methylguanine10 in trna}}
+
{{#set: common-name=udp-α-d-sulfoquinovopyranose}}
 +
{{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}}
 +
{{#set: molecular-weight=627.34}}

Revision as of 11:15, 15 January 2021

Metabolite UDP-SULFOQUINOVOSE

  • common-name:
    • udp-α-d-sulfoquinovopyranose
  • smiles:
    • c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
  • inchi-key:
    • fqancgqcbcusmi-jzmiexbbsa-k
  • molecular-weight:
    • 627.34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality