Difference between revisions of "DNA-deoxycytidine-thymidine-dimer"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...")
(Created page with "Category:metabolite == Metabolite Purine-Bases == * common-name: ** a purine base == Reaction(s) known to consume the compound == * PNP-RXN * RXN-14029 == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-SULFOQUINOVOSE ==
+
== Metabolite Purine-Bases ==
 
* common-name:
 
* common-name:
** udp-α-d-sulfoquinovopyranose
+
** a purine base
* smiles:
 
** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
 
* inchi-key:
 
** fqancgqcbcusmi-jzmiexbbsa-k
 
* molecular-weight:
 
** 627.34
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PNP-RXN]]
 +
* [[RXN-14029]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1223]]
+
* [[PNP-RXN]]
 +
* [[PURINE-NUCLEOSIDASE-RXN]]
 +
* [[RXN-14029]]
 +
* [[RXN-7001]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-sulfoquinovopyranose}}
+
{{#set: common-name=a purine base}}
{{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}}
 
{{#set: molecular-weight=627.34}}
 

Revision as of 08:26, 15 March 2021

Metabolite Purine-Bases

  • common-name:
    • a purine base

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality