Difference between revisions of "DNA-deoxycytidine-thymidine-dimer"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)(...")
(Created page with "Category:metabolite == Metabolite Deoxy-Ribonucleoside-Diphosphates == * common-name: ** a 2'-deoxyribonucleoside 5'-diphosphate == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4203 ==
+
== Metabolite Deoxy-Ribonucleoside-Diphosphates ==
 
* common-name:
 
* common-name:
** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
+
** a 2'-deoxyribonucleoside 5'-diphosphate
* smiles:
 
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
 
* inchi-key:
 
** vxmxkdahjurhen-sdbhatresa-k
 
* molecular-weight:
 
** 492.298
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4311]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4305]]
+
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
* [[RXN-4311]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}}
+
{{#set: common-name=a 2'-deoxyribonucleoside 5'-diphosphate}}
{{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}}
 
{{#set: molecular-weight=492.298}}
 

Revision as of 15:26, 5 January 2021

Metabolite Deoxy-Ribonucleoside-Diphosphates

  • common-name:
    • a 2'-deoxyribonucleoside 5'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality