Difference between revisions of "DNA-with-Uracils"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Lysine == * common-name: ** [fructose-bisphosphate aldolase]-lysine == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9038 == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** precorrin-1 |
| + | * smiles: | ||
| + | ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** cjlvuwulfkhgfb-nzcajupmsa-f | ||
| + | * molecular-weight: | ||
| + | ** 842.768 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8675]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[UROPORIIIMETHYLTRANSA-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=precorrin-1}} |
| + | {{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}} | ||
| + | {{#set: molecular-weight=842.768}} | ||
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-9038
- common-name:
- precorrin-1
- smiles:
- cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
- inchi-key:
- cjlvuwulfkhgfb-nzcajupmsa-f
- molecular-weight:
- 842.768
