Difference between revisions of "DNA-with-mismatch"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite DNA-with-mismatch == * common-name: ** a dna containing a mismatch == Reaction(s) known to consume the compound == * RXN-11049 == Rea...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
+
== Metabolite DNA-with-mismatch ==
 
* common-name:
 
* common-name:
−
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** a dna containing a mismatch
−
* smiles:
 
−
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
−
* inchi-key:
 
−
** htjxtkbiuvfuar-xhibxcghsa-j
 
−
* molecular-weight:
 
−
** 597.259
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-302]]
+
* [[RXN-11049]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.7.1.148-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=a dna containing a mismatch}}
−
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
 
−
{{#set: molecular-weight=597.259}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite DNA-with-mismatch

  • common-name:
    • a dna containing a mismatch

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DNA-with-mismatch&oldid=138131"