Difference between revisions of "DNA-with-mismatch"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1099 == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite DNA-with-mismatch == * common-name: ** a dna containing a mismatch == Reaction(s) known to consume the compound == * RXN-11049 == Rea...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-with-mismatch == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dna containing a mismatch |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11049]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dna containing a mismatch}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DNA-with-mismatch
- common-name:
- a dna containing a mismatch
