Difference between revisions of "DOPAQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14196 RXN-14196] == * direction: ** left-to-right * common-name: ** carbamate phosphorylase * e...")
 
(Created page with "Category:metabolite == Metabolite DOPAQUINONE == * common-name: ** dopaquinone * smiles: ** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1) * inchi-key: ** ahmiduvksgchau-lurjtmie...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14196 RXN-14196] ==
+
== Metabolite DOPAQUINONE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** carbamate phosphorylase
+
** dopaquinone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.2 ec-2.7.2]
+
** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CARBAMATE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CARBAMOYL-P]][c]
+
** ahmiduvksgchau-lurjtmiesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17851]]
+
** 195.174
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13061]]
−
* Gene: [[SJ15949]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=dopaquinone}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=195.174}}
−
* [[PWY-7693]], guadinomine B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7693 PWY-7693]
 
−
** '''3''' reactions found over '''13''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30758 30758]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01395 R01395]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=carbamate phosphorylase}}
 
−
{{#set: ec-number=ec-2.7.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite DOPAQUINONE

  • common-name:
    • dopaquinone
  • smiles:
    • c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
  • inchi-key:
    • ahmiduvksgchau-lurjtmiesa-n
  • molecular-weight:
    • 195.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DOPAQUINONE&oldid=139655"