Difference between revisions of "DPG"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14053 == * common-name: ** (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin * smiles: ** cc(o)c(o)[ch]1(cnc2(n=c(n)nc(c(n1)=2)=o)) * inchi-...")
(Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] * inchi-key: ** ljqlqc...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14053 ==
+
== Metabolite DPG ==
 
* common-name:
 
* common-name:
** (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin
+
** 3-phospho-d-glyceroyl-phosphate
 
* smiles:
 
* smiles:
** cc(o)c(o)[ch]1(cnc2(n=c(n)nc(c(n1)=2)=o))
+
** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** fnkqxyhwgsifbk-rpdrrwsusa-n
+
** ljqlqcaxbuheaz-uwtatzphsa-j
 
* molecular-weight:
 
* molecular-weight:
** 241.249
+
** 262.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
 +
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[RXN-17274]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8853]]
+
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6r)-l-erythro-5,6,7,8-tetrahydrobiopterin}}
+
{{#set: common-name=3-phospho-d-glyceroyl-phosphate}}
{{#set: inchi-key=inchikey=fnkqxyhwgsifbk-rpdrrwsusa-n}}
+
{{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}}
{{#set: molecular-weight=241.249}}
+
{{#set: molecular-weight=262.006}}

Latest revision as of 11:16, 18 March 2021

Metabolite DPG

  • common-name:
    • 3-phospho-d-glyceroyl-phosphate
  • smiles:
    • c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
  • inchi-key:
    • ljqlqcaxbuheaz-uwtatzphsa-j
  • molecular-weight:
    • 262.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality