Difference between revisions of "DTDP-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...")
(Created page with "Category:metabolite == Metabolite 2-O-MeGuan-34-tRNAs == * common-name: ** a 2'-o-methylguanosine34 in trna == Reaction(s) known to consume the compound == == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4207 ==
+
== Metabolite 2-O-MeGuan-34-tRNAs ==
 
* common-name:
 
* common-name:
** isopentenyl adenosine
+
** a 2'-o-methylguanosine34 in trna
* smiles:
 
** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
 
* inchi-key:
 
** usvmjsalorzvdv-sdbhatresa-n
 
* molecular-weight:
 
** 335.362
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4315]]
 
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4315]]
+
* [[RXN-11868]]
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isopentenyl adenosine}}
+
{{#set: common-name=a 2'-o-methylguanosine34 in trna}}
{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
 
{{#set: molecular-weight=335.362}}
 

Revision as of 11:18, 15 January 2021

Metabolite 2-O-MeGuan-34-tRNAs

  • common-name:
    • a 2'-o-methylguanosine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality