Difference between revisions of "DTDP-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...")
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4207 ==
+
== Metabolite DTDP-D-GLUCOSE ==
 
* common-name:
 
* common-name:
** isopentenyl adenosine
+
** dtdp-α-d-glucose
 
* smiles:
 
* smiles:
** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
+
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
 
* inchi-key:
 
* inchi-key:
** usvmjsalorzvdv-sdbhatresa-n
+
** ysykrgrsmltjnl-urarbognsa-l
 
* molecular-weight:
 
* molecular-weight:
** 335.362
+
** 562.317
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4315]]
+
* [[DTDPGLUCDEHYDRAT-RXN]]
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4315]]
 
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isopentenyl adenosine}}
+
{{#set: common-name=dtdp-α-d-glucose}}
{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
+
{{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}}
{{#set: molecular-weight=335.362}}
+
{{#set: molecular-weight=562.317}}

Latest revision as of 11:16, 18 March 2021

Metabolite DTDP-D-GLUCOSE

  • common-name:
    • dtdp-α-d-glucose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
  • inchi-key:
    • ysykrgrsmltjnl-urarbognsa-l
  • molecular-weight:
    • 562.317

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality