Difference between revisions of "DTDP-DEOH-DEOXY-GLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs == * common-name: ** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(c...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose |
| + | * smiles: | ||
| + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3)) | ||
| + | * inchi-key: | ||
| + | ** psxwnitxwwecny-ucbtuhgzsa-l | ||
| + | * molecular-weight: | ||
| + | ** 544.302 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DTDPDEHYDRHAMEPIM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}} |
| + | {{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}} | ||
| + | {{#set: molecular-weight=544.302}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DTDP-DEOH-DEOXY-GLUCOSE
- common-name:
- dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
- inchi-key:
- psxwnitxwwecny-ucbtuhgzsa-l
- molecular-weight:
- 544.302
