Difference between revisions of "DTDP-DEOH-DEOXY-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-NrdH-Proteins == * common-name: ** a reduced nrdh glutaredoxin-like protein == Reaction(s) known to consume the compound == * R...")
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-NrdH-Proteins ==
+
== Metabolite DTDP-DEOH-DEOXY-GLUCOSE ==
 
* common-name:
 
* common-name:
** a reduced nrdh glutaredoxin-like protein
+
** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 +
* inchi-key:
 +
** psxwnitxwwecny-ucbtuhgzsa-l
 +
* molecular-weight:
 +
** 544.302
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+
* [[DTDPDEHYDRHAMEPIM-RXN]]
* [[RXN0-722]]
 
* [[RXN0-747]]
 
* [[RXN0-748]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DTDPGLUCDEHYDRAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced nrdh glutaredoxin-like protein}}
+
{{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}}
 +
{{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}}
 +
{{#set: molecular-weight=544.302}}

Latest revision as of 11:16, 18 March 2021

Metabolite DTDP-DEOH-DEOXY-GLUCOSE

  • common-name:
    • dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
  • inchi-key:
    • psxwnitxwwecny-ucbtuhgzsa-l
  • molecular-weight:
    • 544.302

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality