Difference between revisions of "DTDP-DEOH-DEOXY-GLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYRIBONUCSYN-RXN GLYRIBONUCSYN-RXN] == * direction: ** left-to-right * common-name: ** phosphoribo...") |
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(c...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose |
− | * | + | * smiles: |
− | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3)) |
− | == | + | * inchi-key: |
− | + | ** psxwnitxwwecny-ucbtuhgzsa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 544.302 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[DTDPDEHYDRHAMEPIM-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}} | |
− | + | {{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}} | |
− | == | + | {{#set: molecular-weight=544.302}} |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DTDP-DEOH-DEOXY-GLUCOSE
- common-name:
- dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
- inchi-key:
- psxwnitxwwecny-ucbtuhgzsa-l
- molecular-weight:
- 544.302