Difference between revisions of "DTDP-DEOH-DEOXY-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-698 == * common-name: ** campest-4-en-3-one * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34)))) * in...")
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(c...")
 
(4 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-698 ==
+
== Metabolite DTDP-DEOH-DEOXY-GLUCOSE ==
 
* common-name:
 
* common-name:
** campest-4-en-3-one
+
** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
 
* smiles:
 
* smiles:
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 
* inchi-key:
 
* inchi-key:
** qqiopzfvtihasb-imudckkosa-n
+
** psxwnitxwwecny-ucbtuhgzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 398.671
+
** 544.302
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4231]]
+
* [[DTDPDEHYDRHAMEPIM-RXN]]
* [[RXN-711]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DTDPGLUCDEHYDRAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=campest-4-en-3-one}}
+
{{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}}
{{#set: inchi-key=inchikey=qqiopzfvtihasb-imudckkosa-n}}
+
{{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}}
{{#set: molecular-weight=398.671}}
+
{{#set: molecular-weight=544.302}}

Latest revision as of 11:16, 18 March 2021

Metabolite DTDP-DEOH-DEOXY-GLUCOSE

  • common-name:
    • dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
  • inchi-key:
    • psxwnitxwwecny-ucbtuhgzsa-l
  • molecular-weight:
    • 544.302

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality