Difference between revisions of "DTDP-DEOH-DEOXY-MANNOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...") |
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-MANNOSE == * common-name: ** dtdp-4-dehydro-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DTDP-DEOH-DEOXY-MANNOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** dtdp-4-dehydro-β-l-rhamnose |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** psxwnitxwwecny-lpvgzgshsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 544.302 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DTDPDEHYDRHAMEPIM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dtdp-4-dehydro-β-l-rhamnose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=psxwnitxwwecny-lpvgzgshsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=544.302}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DTDP-DEOH-DEOXY-MANNOSE
- common-name:
- dtdp-4-dehydro-β-l-rhamnose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
- inchi-key:
- psxwnitxwwecny-lpvgzgshsa-l
- molecular-weight:
- 544.302