Difference between revisions of "DTDP-DEOH-DEOXY-MANNOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21817 == * transcription-direction: ** positive * right-end-position: ** 58022 * left-end-position: ** 53154 * centisome-position: ** 28.611723...") |
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-MANNOSE == * common-name: ** dtdp-4-dehydro-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DTDP-DEOH-DEOXY-MANNOSE == |
− | * | + | * common-name: |
− | ** | + | ** dtdp-4-dehydro-β-l-rhamnose |
− | + | * smiles: | |
− | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3)) | |
− | + | * inchi-key: | |
− | * | + | ** psxwnitxwwecny-lpvgzgshsa-l |
− | + | * molecular-weight: | |
− | ** | + | ** 544.302 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[DTDPDEHYRHAMREDUCT-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DTDPDEHYDRHAMEPIM-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=dtdp-4-dehydro-β-l-rhamnose}} | |
− | + | {{#set: inchi-key=inchikey=psxwnitxwwecny-lpvgzgshsa-l}} | |
− | + | {{#set: molecular-weight=544.302}} | |
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DTDP-DEOH-DEOXY-MANNOSE
- common-name:
- dtdp-4-dehydro-β-l-rhamnose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
- inchi-key:
- psxwnitxwwecny-lpvgzgshsa-l
- molecular-weight:
- 544.302