Difference between revisions of "DTDP-RHAMNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...")
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4209 ==
+
== Metabolite DTDP-RHAMNOSE ==
 
* common-name:
 
* common-name:
** n6-dimethylallyladenine
+
** dtdp-β-l-rhamnose
 
* smiles:
 
* smiles:
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
+
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
 
* inchi-key:
 
* inchi-key:
** hyvabzigrdekcd-uhfffaoysa-n
+
** zosqfdvxnqfkby-cgaxjhmrsa-l
 
* molecular-weight:
 
* molecular-weight:
** 203.246
+
** 546.317
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.99.12-RXN]]
 
* [[RXN-4315]]
 
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.5.99.12-RXN]]
+
* [[DTDPDEHYRHAMREDUCT-RXN]]
* [[RXN-4313]]
 
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 
* [[RXN-4315]]
 
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-dimethylallyladenine}}
+
{{#set: common-name=dtdp-β-l-rhamnose}}
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}
{{#set: molecular-weight=203.246}}
+
{{#set: molecular-weight=546.317}}

Latest revision as of 11:14, 18 March 2021

Metabolite DTDP-RHAMNOSE

  • common-name:
    • dtdp-β-l-rhamnose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
  • inchi-key:
    • zosqfdvxnqfkby-cgaxjhmrsa-l
  • molecular-weight:
    • 546.317

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality