Difference between revisions of "DTDP-RHAMNOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19948 == * transcription-direction: ** negative * right-end-position: ** 48368 * left-end-position: ** 36599 * centisome-position: ** 16.842226...") |
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DTDP-RHAMNOSE == |
| − | * | + | * common-name: |
| − | ** | + | ** dtdp-β-l-rhamnose |
| − | * | + | * smiles: |
| − | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** zosqfdvxnqfkby-cgaxjhmrsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 546.317 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=dtdp-β-l-rhamnose}} | |
| − | + | {{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}} | |
| − | + | {{#set: molecular-weight=546.317}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DTDP-RHAMNOSE
- common-name:
- dtdp-β-l-rhamnose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
- inchi-key:
- zosqfdvxnqfkby-cgaxjhmrsa-l
- molecular-weight:
- 546.317
