Difference between revisions of "DTDP-RHAMNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Phosphothreonines == * common-name: ** a [protein] l-threonine phosphate == Reaction(s) known to consume the compound == * RXN-...")
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c...")
 
(4 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-Phosphothreonines ==
+
== Metabolite DTDP-RHAMNOSE ==
 
* common-name:
 
* common-name:
** a [protein] l-threonine phosphate
+
** dtdp-β-l-rhamnose
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
 +
* inchi-key:
 +
** zosqfdvxnqfkby-cgaxjhmrsa-l
 +
* molecular-weight:
 +
** 546.317
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14906]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14906]]
+
* [[DTDPDEHYRHAMREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein] l-threonine phosphate}}
+
{{#set: common-name=dtdp-β-l-rhamnose}}
 +
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}
 +
{{#set: molecular-weight=546.317}}

Latest revision as of 11:14, 18 March 2021

Metabolite DTDP-RHAMNOSE

  • common-name:
    • dtdp-β-l-rhamnose
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
  • inchi-key:
    • zosqfdvxnqfkby-cgaxjhmrsa-l
  • molecular-weight:
    • 546.317

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality