Difference between revisions of "DUDP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00969 == * transcription-direction: ** positive * right-end-position: ** 94055 * left-end-position: ** 89453 * centisome-position: ** 56.285942...") |
(Created page with "Category:metabolite == Metabolite DUDP == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** qhwztvccbmii...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DUDP == |
− | * | + | * common-name: |
− | ** | + | ** dudp |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) |
− | * | + | * inchi-key: |
− | ** | + | ** qhwztvccbmiike-shyzeuofsa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 385.14 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ATDUD]] |
− | + | * [[ATDUDm]] | |
− | * [[ | + | * [[DUDPKIN-RXN]] |
− | * | + | * [[RXN-14220]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[DUDT]] |
− | * | + | * [[DUTCP]] |
− | * | + | * [[DUTUP]] |
− | {{#set: | + | * [[RXN-14219]] |
− | {{#set: | + | * [[RXN0-722]] |
− | + | * [[UDPREDUCT-RXN]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=dudp}} | |
− | + | {{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}} | |
+ | {{#set: molecular-weight=385.14}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DUDP
- common-name:
- dudp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- qhwztvccbmiike-shyzeuofsa-k
- molecular-weight:
- 385.14