Difference between revisions of "DUDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7598 == * common-name: ** anandamide * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco * inchi-key: ** lgeqqwmqcriykg-dofzraljsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite DUDP == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** qhwztvccbmii...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DUDP == |
* common-name: | * common-name: | ||
− | ** | + | ** dudp |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qhwztvccbmiike-shyzeuofsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 385.14 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ATDUD]] |
+ | * [[ATDUDm]] | ||
+ | * [[DUDPKIN-RXN]] | ||
+ | * [[RXN-14220]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DUDT]] | ||
+ | * [[DUTCP]] | ||
+ | * [[DUTUP]] | ||
+ | * [[RXN-14219]] | ||
+ | * [[RXN0-722]] | ||
+ | * [[UDPREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dudp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=385.14}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DUDP
- common-name:
- dudp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- qhwztvccbmiike-shyzeuofsa-k
- molecular-weight:
- 385.14