Difference between revisions of "DUDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05001 == * transcription-direction: ** negative * right-end-position: ** 124254 * left-end-position: ** 116058 * centisome-position: ** 12.018839...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05001 ==
+
== Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** melatonin
−
* right-end-position:
+
* smiles:
−
** 124254
+
** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
−
* left-end-position:
+
* inchi-key:
−
** 116058
+
** drlfmbdrbrzale-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 12.018839   
+
** 232.282
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11056]]
−
== Reaction(s) associated ==
+
* [[RXN-11057]]
−
* [[GTP-CYCLOHYDRO-II-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=melatonin}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=232.282}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[RIBOSYN2-PWY]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6168]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=124254}}
 
−
{{#set: left-end-position=116058}}
 
−
{{#set: centisome-position=12.018839    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:32, 18 December 2020

Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE

  • common-name:
    • melatonin
  • smiles:
    • cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
  • inchi-key:
    • drlfmbdrbrzale-uhfffaoysa-n
  • molecular-weight:
    • 232.282

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DUDP&oldid=46519"